About prop-2-enyl 5-bromo-3-(2-hydroxy-3-oxo-3-prop-2-enoxypropyl)-1H-indole-2-carboxylate
prop-2-enyl 5-bromo-3-(2-hydroxy-3-oxo-3-prop-2-enoxypropyl)-1H-indole-2-carboxylate (PubChem CID 141482023) has the molecular formula C18H18BrNO5
and a molecular weight of 408.25 g/mol. Its IUPAC name is prop-2-enyl 5-bromo-3-(2-hydroxy-3-oxo-3-prop-2-enoxypropyl)-1H-indole-2-carboxylate.
Molecular Properties
| Compound Name | prop-2-enyl 5-bromo-3-(2-hydroxy-3-oxo-3-prop-2-enoxypropyl)-1H-indole-2-carboxylate |
| PubChem CID | 141482023 |
| Molecular Formula | C18H18BrNO5 |
| Molecular Weight | 408.25 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | prop-2-enyl 5-bromo-3-(2-hydroxy-3-oxo-3-prop-2-enoxypropyl)-1H-indole-2-carboxylate |
| SMILES | C=CCOC(=O)c1[nH]c2ccc(Br)cc2c1CC(O)C(=O)OCC=C |
| InChI | InChI=1S/C18H18BrNO5/c1-3-7-24-17(22)15(21)10-13-12-9-11(19)5-6-14(12)20-16(13)18(23)25-8-4-2/h3-6,9,15,20-21H,1-2,7-8,10H2 |
| InChIKey | MPBLGZBXNKCPAC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 5-bromo-3-(2-hydroxy-3-oxo-3-prop-2-enoxypropyl)-1H-indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 5-bromo-3-(2-hydroxy-3-oxo-3-prop-2-enoxypropyl)-1H-indole-2-carboxylate?
The IUPAC name of prop-2-enyl 5-bromo-3-(2-hydroxy-3-oxo-3-prop-2-enoxypropyl)-1H-indole-2-carboxylate (CID 141482023) is prop-2-enyl 5-bromo-3-(2-hydroxy-3-oxo-3-prop-2-enoxypropyl)-1H-indole-2-carboxylate.
What is the SMILES notation for prop-2-enyl 5-bromo-3-(2-hydroxy-3-oxo-3-prop-2-enoxypropyl)-1H-indole-2-carboxylate?
The canonical SMILES for prop-2-enyl 5-bromo-3-(2-hydroxy-3-oxo-3-prop-2-enoxypropyl)-1H-indole-2-carboxylate is C=CCOC(=O)c1[nH]c2ccc(Br)cc2c1CC(O)C(=O)OCC=C.
What is the InChIKey of prop-2-enyl 5-bromo-3-(2-hydroxy-3-oxo-3-prop-2-enoxypropyl)-1H-indole-2-carboxylate?
The InChIKey is MPBLGZBXNKCPAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18BrNO5/c1-3-7-24-17(22)15(21)10-13-12-9-11(19)5-6-14(12)20-16(13)18(23)25-8-4-2/h3-6,9,15,20-21H,1-2,7-8,10H2.
What are the key properties of prop-2-enyl 5-bromo-3-(2-hydroxy-3-oxo-3-prop-2-enoxypropyl)-1H-indole-2-carboxylate?
prop-2-enyl 5-bromo-3-(2-hydroxy-3-oxo-3-prop-2-enoxypropyl)-1H-indole-2-carboxylate has a molecular weight of 408.25 g/mol, XLogP of 2.91, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 5-bromo-3-(2-hydroxy-3-oxo-3-prop-2-enoxypropyl)-1H-indole-2-carboxylate is sourced from PubChem (CID 141482023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).