C18H18BrNO5 — CID 141482023
prop-2-enyl 5-bromo-3-(2-hydroxy-3-oxo-3-prop-2-enoxypropyl)-1H-indole-2-carboxylate (PubChem CID 141482023) has the molecular formula C18H18BrNO5 and a molecular weight of 408.25 g/mol. Its IUPAC name is prop-2-enyl 5-bromo-3-(2-hydroxy-3-oxo-3-prop-2-enoxypropyl)-1H-indole-2-carboxylate.
| Compound Name | prop-2-enyl 5-bromo-3-(2-hydroxy-3-oxo-3-prop-2-enoxypropyl)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 141482023 |
| Molecular Formula | C18H18BrNO5 |
| Molecular Weight | 408.25 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | prop-2-enyl 5-bromo-3-(2-hydroxy-3-oxo-3-prop-2-enoxypropyl)-1H-indole-2-carboxylate |
| SMILES | C=CCOC(=O)c1[nH]c2ccc(Br)cc2c1CC(O)C(=O)OCC=C |
| InChI | InChI=1S/C18H18BrNO5/c1-3-7-24-17(22)15(21)10-13-12-9-11(19)5-6-14(12)20-16(13)18(23)25-8-4-2/h3-6,9,15,20-21H,1-2,7-8,10H2 |
| InChIKey | MPBLGZBXNKCPAC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|