About methyl 3-amino-5,6-dibromopyrazine-2-carboxylate
methyl 3-amino-5,6-dibromopyrazine-2-carboxylate (PubChem CID 141482707) has the molecular formula C6H5Br2N3O2
and a molecular weight of 310.93 g/mol. Its IUPAC name is methyl 3-amino-5,6-dibromopyrazine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-amino-5,6-dibromopyrazine-2-carboxylate |
| PubChem CID | 141482707 |
| Molecular Formula | C6H5Br2N3O2 |
| Molecular Weight | 310.93 g/mol |
| Exact Mass | 308.87 |
| IUPAC Name | methyl 3-amino-5,6-dibromopyrazine-2-carboxylate |
| SMILES | COC(=O)c1nc(Br)c(Br)nc1N |
| InChI | InChI=1S/C6H5Br2N3O2/c1-13-6(12)2-5(9)11-4(8)3(7)10-2/h1H3,(H2,9,11) |
| InChIKey | SZBZQXNUHNQIJV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.93 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-amino-5,6-dibromopyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-amino-5,6-dibromopyrazine-2-carboxylate?
The IUPAC name of methyl 3-amino-5,6-dibromopyrazine-2-carboxylate (CID 141482707) is methyl 3-amino-5,6-dibromopyrazine-2-carboxylate.
What is the SMILES notation for methyl 3-amino-5,6-dibromopyrazine-2-carboxylate?
The canonical SMILES for methyl 3-amino-5,6-dibromopyrazine-2-carboxylate is COC(=O)c1nc(Br)c(Br)nc1N.
What is the InChIKey of methyl 3-amino-5,6-dibromopyrazine-2-carboxylate?
The InChIKey is SZBZQXNUHNQIJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Br2N3O2/c1-13-6(12)2-5(9)11-4(8)3(7)10-2/h1H3,(H2,9,11).
What are the key properties of methyl 3-amino-5,6-dibromopyrazine-2-carboxylate?
methyl 3-amino-5,6-dibromopyrazine-2-carboxylate has a molecular weight of 310.93 g/mol, XLogP of 1.37, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-amino-5,6-dibromopyrazine-2-carboxylate is sourced from PubChem (CID 141482707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).