C18H35NO3 — CID 141483442
N-[(E,2R,3S)-1,3-dihydroxyhexadec-4-en-2-yl]acetamide (PubChem CID 141483442) has the molecular formula C18H35NO3 and a molecular weight of 313.48 g/mol. Its IUPAC name is N-[(E,2R,3S)-1,3-dihydroxyhexadec-4-en-2-yl]acetamide.
| Compound Name | N-[(E,2R,3S)-1,3-dihydroxyhexadec-4-en-2-yl]acetamide |
|---|---|
| PubChem CID | 141483442 |
| Molecular Formula | C18H35NO3 |
| Molecular Weight | 313.48 g/mol |
| Exact Mass | 313.26 |
| IUPAC Name | N-[(E,2R,3S)-1,3-dihydroxyhexadec-4-en-2-yl]acetamide |
| SMILES | CCCCCCCCCCC/C=C/[C@H](O)[C@@H](CO)NC(C)=O |
| InChI | InChI=1S/C18H35NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-18(22)17(15-20)19-16(2)21/h13-14,17-18,20,22H,3-12,15H2,1-2H3,(H,19,21)/b14-13+/t17-,18+/m1/s1 |
| InChIKey | WCGRKWCZJCCFOR-JUWLWVHDSA-N |
| XLogP | 3.32 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|