C12H16FN3O3 — CID 141483623
tert-butyl [[N'-(4-fluorophenyl)carbamimidoyl]amino] carbonate (PubChem CID 141483623) has the molecular formula C12H16FN3O3 and a molecular weight of 269.28 g/mol. Its IUPAC name is tert-butyl [[N'-(4-fluorophenyl)carbamimidoyl]amino] carbonate.
| Compound Name | tert-butyl [[N'-(4-fluorophenyl)carbamimidoyl]amino] carbonate |
|---|---|
| PubChem CID | 141483623 |
| Molecular Formula | C12H16FN3O3 |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | tert-butyl [[N'-(4-fluorophenyl)carbamimidoyl]amino] carbonate |
| SMILES | CC(C)(C)OC(=O)ON/C(N)=N/c1ccc(F)cc1 |
| InChI | InChI=1S/C12H16FN3O3/c1-12(2,3)18-11(17)19-16-10(14)15-9-6-4-8(13)5-7-9/h4-7H,1-3H3,(H3,14,15,16) |
| InChIKey | SQIHVVGVKABSKN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|