About 6-chloro-3-[(3,5-ditert-butyl-4-hydroxyphenyl)-phenylmethyl]-4-hydroxychromen-2-one
6-chloro-3-[(3,5-ditert-butyl-4-hydroxyphenyl)-phenylmethyl]-4-hydroxychromen-2-one (PubChem CID 141484105) has the molecular formula C30H31ClO4
and a molecular weight of 491.03 g/mol. Its IUPAC name is 6-chloro-3-[(3,5-ditert-butyl-4-hydroxyphenyl)-phenylmethyl]-4-hydroxychromen-2-one.
Molecular Properties
| Compound Name | 6-chloro-3-[(3,5-ditert-butyl-4-hydroxyphenyl)-phenylmethyl]-4-hydroxychromen-2-one |
| PubChem CID | 141484105 |
| Molecular Formula | C30H31ClO4 |
| Molecular Weight | 491.03 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 6-chloro-3-[(3,5-ditert-butyl-4-hydroxyphenyl)-phenylmethyl]-4-hydroxychromen-2-one |
| SMILES | CC(C)(C)c1cc(C(c2ccccc2)c2c(O)c3cc(Cl)ccc3oc2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C30H31ClO4/c1-29(2,3)21-14-18(15-22(27(21)33)30(4,5)6)24(17-10-8-7-9-11-17)25-26(32)20-16-19(31)12-13-23(20)35-28(25)34/h7-16,24,32-33H,1-6H3 |
| InChIKey | KYZAVENZQKWWFH-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 491.03 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-3-[(3,5-ditert-butyl-4-hydroxyphenyl)-phenylmethyl]-4-hydroxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-[(3,5-ditert-butyl-4-hydroxyphenyl)-phenylmethyl]-4-hydroxychromen-2-one?
The IUPAC name of 6-chloro-3-[(3,5-ditert-butyl-4-hydroxyphenyl)-phenylmethyl]-4-hydroxychromen-2-one (CID 141484105) is 6-chloro-3-[(3,5-ditert-butyl-4-hydroxyphenyl)-phenylmethyl]-4-hydroxychromen-2-one.
What is the SMILES notation for 6-chloro-3-[(3,5-ditert-butyl-4-hydroxyphenyl)-phenylmethyl]-4-hydroxychromen-2-one?
The canonical SMILES for 6-chloro-3-[(3,5-ditert-butyl-4-hydroxyphenyl)-phenylmethyl]-4-hydroxychromen-2-one is CC(C)(C)c1cc(C(c2ccccc2)c2c(O)c3cc(Cl)ccc3oc2=O)cc(C(C)(C)C)c1O.
What is the InChIKey of 6-chloro-3-[(3,5-ditert-butyl-4-hydroxyphenyl)-phenylmethyl]-4-hydroxychromen-2-one?
The InChIKey is KYZAVENZQKWWFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H31ClO4/c1-29(2,3)21-14-18(15-22(27(21)33)30(4,5)6)24(17-10-8-7-9-11-17)25-26(32)20-16-19(31)12-13-23(20)35-28(25)34/h7-16,24,32-33H,1-6H3.
What are the key properties of 6-chloro-3-[(3,5-ditert-butyl-4-hydroxyphenyl)-phenylmethyl]-4-hydroxychromen-2-one?
6-chloro-3-[(3,5-ditert-butyl-4-hydroxyphenyl)-phenylmethyl]-4-hydroxychromen-2-one has a molecular weight of 491.03 g/mol, XLogP of 7.63, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-[(3,5-ditert-butyl-4-hydroxyphenyl)-phenylmethyl]-4-hydroxychromen-2-one is sourced from PubChem (CID 141484105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).