C17H23BrFN7O4S — CID 141484189
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[[4-[(sulfamoylamino)methyl]cyclohexyl]methylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 141484189) has the molecular formula C17H23BrFN7O4S and a molecular weight of 520.39 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[[4-[(sulfamoylamino)methyl]cyclohexyl]methylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[[4-[(sulfamoylamino)methyl]cyclohexyl]methylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 141484189 |
| Molecular Formula | C17H23BrFN7O4S |
| Molecular Weight | 520.39 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[[4-[(sulfamoylamino)methyl]cyclohexyl]methylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NS(=O)(=O)NCC1CCC(CNc2nonc2/C(=N/c2ccc(F)c(Br)c2)NO)CC1 |
| InChI | InChI=1S/C17H23BrFN7O4S/c18-13-7-12(5-6-14(13)19)23-17(24-27)15-16(26-30-25-15)21-8-10-1-3-11(4-2-10)9-22-31(20,28)29/h5-7,10-11,22,27H,1-4,8-9H2,(H,21,26)(H,23,24)(H2,20,28,29) |
| InChIKey | HFPZZMHHJARJCR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 167.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|