C16H19NO2 — CID 141484777
4-hepta-3,6-dienyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 141484777) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 4-hepta-3,6-dienyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-hepta-3,6-dienyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 141484777 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 4-hepta-3,6-dienyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | C=CCC=CCCN1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C16H19NO2/c1-2-3-4-5-6-9-17-15(18)13-11-7-8-12(10-11)14(13)16(17)19/h2,4-5,7-8,11-14H,1,3,6,9-10H2 |
| InChIKey | VHOJCOBJEHWOCT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|