About 2-dec-1-enyl-N,N-bis(2-hydroxyethyl)butanediamide
2-dec-1-enyl-N,N-bis(2-hydroxyethyl)butanediamide (PubChem CID 141484951) has the molecular formula C18H34N2O4
and a molecular weight of 342.48 g/mol. Its IUPAC name is 2-dec-1-enyl-N,N-bis(2-hydroxyethyl)butanediamide.
Molecular Properties
| Compound Name | 2-dec-1-enyl-N,N-bis(2-hydroxyethyl)butanediamide |
| PubChem CID | 141484951 |
| Molecular Formula | C18H34N2O4 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | 2-dec-1-enyl-N,N-bis(2-hydroxyethyl)butanediamide |
| SMILES | CCCCCCCCC=CC(CC(N)=O)C(=O)N(CCO)CCO |
| InChI | InChI=1S/C18H34N2O4/c1-2-3-4-5-6-7-8-9-10-16(15-17(19)23)18(24)20(11-13-21)12-14-22/h9-10,16,21-22H,2-8,11-15H2,1H3,(H2,19,23) |
| InChIKey | RTQSCBDKKXXUJG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-dec-1-enyl-N,N-bis(2-hydroxyethyl)butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dec-1-enyl-N,N-bis(2-hydroxyethyl)butanediamide?
The IUPAC name of 2-dec-1-enyl-N,N-bis(2-hydroxyethyl)butanediamide (CID 141484951) is 2-dec-1-enyl-N,N-bis(2-hydroxyethyl)butanediamide.
What is the SMILES notation for 2-dec-1-enyl-N,N-bis(2-hydroxyethyl)butanediamide?
The canonical SMILES for 2-dec-1-enyl-N,N-bis(2-hydroxyethyl)butanediamide is CCCCCCCCC=CC(CC(N)=O)C(=O)N(CCO)CCO.
What is the InChIKey of 2-dec-1-enyl-N,N-bis(2-hydroxyethyl)butanediamide?
The InChIKey is RTQSCBDKKXXUJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34N2O4/c1-2-3-4-5-6-7-8-9-10-16(15-17(19)23)18(24)20(11-13-21)12-14-22/h9-10,16,21-22H,2-8,11-15H2,1H3,(H2,19,23).
What are the key properties of 2-dec-1-enyl-N,N-bis(2-hydroxyethyl)butanediamide?
2-dec-1-enyl-N,N-bis(2-hydroxyethyl)butanediamide has a molecular weight of 342.48 g/mol, XLogP of 1.60, 15 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dec-1-enyl-N,N-bis(2-hydroxyethyl)butanediamide is sourced from PubChem (CID 141484951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).