About bis(1H-pyrazole-5-carboxylic acid);zinc
bis(1H-pyrazole-5-carboxylic acid);zinc (PubChem CID 141485018) has the molecular formula C8H8N4O4Zn
and a molecular weight of 289.57 g/mol. Its IUPAC name is bis(1H-pyrazole-5-carboxylic acid);zinc.
Molecular Properties
| Compound Name | bis(1H-pyrazole-5-carboxylic acid);zinc |
| PubChem CID | 141485018 |
| Molecular Formula | C8H8N4O4Zn |
| Molecular Weight | 289.57 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | bis(1H-pyrazole-5-carboxylic acid);zinc |
| SMILES | O=C(O)c1ccn[nH]1.O=C(O)c1ccn[nH]1.[Zn] |
| InChI | InChI=1S/2C4H4N2O2.Zn/c2*7-4(8)3-1-2-5-6-3;/h2*1-2H,(H,5,6)(H,7,8); |
| InChIKey | QZJFLFGVRPBELO-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 131.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.57 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(1H-pyrazole-5-carboxylic acid);zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1H-pyrazole-5-carboxylic acid);zinc?
The IUPAC name of bis(1H-pyrazole-5-carboxylic acid);zinc (CID 141485018) is bis(1H-pyrazole-5-carboxylic acid);zinc.
What is the SMILES notation for bis(1H-pyrazole-5-carboxylic acid);zinc?
The canonical SMILES for bis(1H-pyrazole-5-carboxylic acid);zinc is O=C(O)c1ccn[nH]1.O=C(O)c1ccn[nH]1.[Zn].
What is the InChIKey of bis(1H-pyrazole-5-carboxylic acid);zinc?
The InChIKey is QZJFLFGVRPBELO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H4N2O2.Zn/c2*7-4(8)3-1-2-5-6-3;/h2*1-2H,(H,5,6)(H,7,8);.
What are the key properties of bis(1H-pyrazole-5-carboxylic acid);zinc?
bis(1H-pyrazole-5-carboxylic acid);zinc has a molecular weight of 289.57 g/mol, XLogP of 0.21, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1H-pyrazole-5-carboxylic acid);zinc is sourced from PubChem (CID 141485018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).