C20H26BNO3 — CID 141485100
N-[(1R)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-benzofuran-1-amine (PubChem CID 141485100) has the molecular formula C20H26BNO3 and a molecular weight of 339.24 g/mol. Its IUPAC name is N-[(1R)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-benzofuran-1-amine.
| Compound Name | N-[(1R)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-benzofuran-1-amine |
|---|---|
| PubChem CID | 141485100 |
| Molecular Formula | C20H26BNO3 |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | N-[(1R)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-benzofuran-1-amine |
| SMILES | C[C@H](Nc1occ2ccccc12)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C20H26BNO3/c1-12(22-18-15-8-6-5-7-13(15)11-23-18)21-24-17-10-14-9-16(19(14,2)3)20(17,4)25-21/h5-8,11-12,14,16-17,22H,9-10H2,1-4H3/t12-,14-,16-,17+,20-/m0/s1 |
| InChIKey | HMUXTWUGGYGXKR-XIXOBYHESA-N |
| XLogP | 4.50 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|