About 1,5-dimethylimidazo[4,5-c]pyridin-4-one
1,5-dimethylimidazo[4,5-c]pyridin-4-one (PubChem CID 14148531) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 1,5-dimethylimidazo[4,5-c]pyridin-4-one.
Molecular Properties
| Compound Name | 1,5-dimethylimidazo[4,5-c]pyridin-4-one |
| PubChem CID | 14148531 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 1,5-dimethylimidazo[4,5-c]pyridin-4-one |
| SMILES | Cn1ccc2c(ncn2C)c1=O |
| InChI | InChI=1S/C8H9N3O/c1-10-4-3-6-7(8(10)12)9-5-11(6)2/h3-5H,1-2H3 |
| InChIKey | MATOXYYPXVZHPM-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,5-dimethylimidazo[4,5-c]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethylimidazo[4,5-c]pyridin-4-one?
The IUPAC name of 1,5-dimethylimidazo[4,5-c]pyridin-4-one (CID 14148531) is 1,5-dimethylimidazo[4,5-c]pyridin-4-one.
What is the SMILES notation for 1,5-dimethylimidazo[4,5-c]pyridin-4-one?
The canonical SMILES for 1,5-dimethylimidazo[4,5-c]pyridin-4-one is Cn1ccc2c(ncn2C)c1=O.
What is the InChIKey of 1,5-dimethylimidazo[4,5-c]pyridin-4-one?
The InChIKey is MATOXYYPXVZHPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c1-10-4-3-6-7(8(10)12)9-5-11(6)2/h3-5H,1-2H3.
What are the key properties of 1,5-dimethylimidazo[4,5-c]pyridin-4-one?
1,5-dimethylimidazo[4,5-c]pyridin-4-one has a molecular weight of 163.18 g/mol, XLogP of 0.27, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethylimidazo[4,5-c]pyridin-4-one is sourced from PubChem (CID 14148531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).