About 5-isocyanato-5,6-dimethyl-1-prop-1-en-2-ylcyclohexa-1,3-diene
5-isocyanato-5,6-dimethyl-1-prop-1-en-2-ylcyclohexa-1,3-diene (PubChem CID 141485317) has the molecular formula C12H15NO
and a molecular weight of 189.26 g/mol. Its IUPAC name is 5-isocyanato-5,6-dimethyl-1-prop-1-en-2-ylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5-isocyanato-5,6-dimethyl-1-prop-1-en-2-ylcyclohexa-1,3-diene |
| PubChem CID | 141485317 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 5-isocyanato-5,6-dimethyl-1-prop-1-en-2-ylcyclohexa-1,3-diene |
| SMILES | C=C(C)C1=CC=CC(C)(N=C=O)C1C |
| InChI | InChI=1S/C12H15NO/c1-9(2)11-6-5-7-12(4,10(11)3)13-8-14/h5-7,10H,1H2,2-4H3 |
| InChIKey | BNZXRAMGUGNABP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 5-isocyanato-5,6-dimethyl-1-prop-1-en-2-ylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-isocyanato-5,6-dimethyl-1-prop-1-en-2-ylcyclohexa-1,3-diene?
The IUPAC name of 5-isocyanato-5,6-dimethyl-1-prop-1-en-2-ylcyclohexa-1,3-diene (CID 141485317) is 5-isocyanato-5,6-dimethyl-1-prop-1-en-2-ylcyclohexa-1,3-diene.
What is the SMILES notation for 5-isocyanato-5,6-dimethyl-1-prop-1-en-2-ylcyclohexa-1,3-diene?
The canonical SMILES for 5-isocyanato-5,6-dimethyl-1-prop-1-en-2-ylcyclohexa-1,3-diene is C=C(C)C1=CC=CC(C)(N=C=O)C1C.
What is the InChIKey of 5-isocyanato-5,6-dimethyl-1-prop-1-en-2-ylcyclohexa-1,3-diene?
The InChIKey is BNZXRAMGUGNABP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO/c1-9(2)11-6-5-7-12(4,10(11)3)13-8-14/h5-7,10H,1H2,2-4H3.
What are the key properties of 5-isocyanato-5,6-dimethyl-1-prop-1-en-2-ylcyclohexa-1,3-diene?
5-isocyanato-5,6-dimethyl-1-prop-1-en-2-ylcyclohexa-1,3-diene has a molecular weight of 189.26 g/mol, XLogP of 2.79, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-isocyanato-5,6-dimethyl-1-prop-1-en-2-ylcyclohexa-1,3-diene is sourced from PubChem (CID 141485317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).