About [(2R,3S,4S)-4-fluoro-5-hydroxy-3-methoxycarbonyloxythiolan-2-yl]methyl acetate
[(2R,3S,4S)-4-fluoro-5-hydroxy-3-methoxycarbonyloxythiolan-2-yl]methyl acetate (PubChem CID 141485971) has the molecular formula C9H13FO6S
and a molecular weight of 268.26 g/mol. Its IUPAC name is [(2R,3S,4S)-4-fluoro-5-hydroxy-3-methoxycarbonyloxythiolan-2-yl]methyl acetate.
Molecular Properties
| Compound Name | [(2R,3S,4S)-4-fluoro-5-hydroxy-3-methoxycarbonyloxythiolan-2-yl]methyl acetate |
| PubChem CID | 141485971 |
| Molecular Formula | C9H13FO6S |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | [(2R,3S,4S)-4-fluoro-5-hydroxy-3-methoxycarbonyloxythiolan-2-yl]methyl acetate |
| SMILES | COC(=O)O[C@H]1[C@H](F)C(O)S[C@@H]1COC(C)=O |
| InChI | InChI=1S/C9H13FO6S/c1-4(11)15-3-5-7(16-9(13)14-2)6(10)8(12)17-5/h5-8,12H,3H2,1-2H3/t5-,6+,7-,8?/m1/s1 |
| InChIKey | BSZJUCDVKDGTJY-MOMMNUENSA-N |
| XLogP | 0.47 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [(2R,3S,4S)-4-fluoro-5-hydroxy-3-methoxycarbonyloxythiolan-2-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3S,4S)-4-fluoro-5-hydroxy-3-methoxycarbonyloxythiolan-2-yl]methyl acetate?
The IUPAC name of [(2R,3S,4S)-4-fluoro-5-hydroxy-3-methoxycarbonyloxythiolan-2-yl]methyl acetate (CID 141485971) is [(2R,3S,4S)-4-fluoro-5-hydroxy-3-methoxycarbonyloxythiolan-2-yl]methyl acetate.
What is the SMILES notation for [(2R,3S,4S)-4-fluoro-5-hydroxy-3-methoxycarbonyloxythiolan-2-yl]methyl acetate?
The canonical SMILES for [(2R,3S,4S)-4-fluoro-5-hydroxy-3-methoxycarbonyloxythiolan-2-yl]methyl acetate is COC(=O)O[C@H]1[C@H](F)C(O)S[C@@H]1COC(C)=O.
What is the InChIKey of [(2R,3S,4S)-4-fluoro-5-hydroxy-3-methoxycarbonyloxythiolan-2-yl]methyl acetate?
The InChIKey is BSZJUCDVKDGTJY-MOMMNUENSA-N. The full InChI is InChI=1S/C9H13FO6S/c1-4(11)15-3-5-7(16-9(13)14-2)6(10)8(12)17-5/h5-8,12H,3H2,1-2H3/t5-,6+,7-,8?/m1/s1.
What are the key properties of [(2R,3S,4S)-4-fluoro-5-hydroxy-3-methoxycarbonyloxythiolan-2-yl]methyl acetate?
[(2R,3S,4S)-4-fluoro-5-hydroxy-3-methoxycarbonyloxythiolan-2-yl]methyl acetate has a molecular weight of 268.26 g/mol, XLogP of 0.47, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3S,4S)-4-fluoro-5-hydroxy-3-methoxycarbonyloxythiolan-2-yl]methyl acetate is sourced from PubChem (CID 141485971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).