About (2R)-2-(3-chloro-5-fluoroanilino)-4-[iodo(dimethyl)-λ4-sulfanyl]butanoic acid
(2R)-2-(3-chloro-5-fluoroanilino)-4-[iodo(dimethyl)-λ4-sulfanyl]butanoic acid (PubChem CID 141485997) has the molecular formula C12H16ClFINO2S
and a molecular weight of 419.69 g/mol. Its IUPAC name is (2R)-2-(3-chloro-5-fluoroanilino)-4-[iodo(dimethyl)-λ4-sulfanyl]butanoic acid.
Molecular Properties
| Compound Name | (2R)-2-(3-chloro-5-fluoroanilino)-4-[iodo(dimethyl)-λ4-sulfanyl]butanoic acid |
| PubChem CID | 141485997 |
| Molecular Formula | C12H16ClFINO2S |
| Molecular Weight | 419.69 g/mol |
| Exact Mass | 418.96 |
| IUPAC Name | (2R)-2-(3-chloro-5-fluoroanilino)-4-[iodo(dimethyl)-λ4-sulfanyl]butanoic acid |
| SMILES | CS(C)(I)CC[C@@H](Nc1cc(F)cc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C12H16ClFINO2S/c1-19(2,15)4-3-11(12(17)18)16-10-6-8(13)5-9(14)7-10/h5-7,11,16H,3-4H2,1-2H3,(H,17,18)/t11-/m1/s1 |
| InChIKey | QABROOWLWNNCKQ-LLVKDONJSA-N |
| XLogP | 4.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.69 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-(3-chloro-5-fluoroanilino)-4-[iodo(dimethyl)-λ4-sulfanyl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(3-chloro-5-fluoroanilino)-4-[iodo(dimethyl)-λ4-sulfanyl]butanoic acid?
The IUPAC name of (2R)-2-(3-chloro-5-fluoroanilino)-4-[iodo(dimethyl)-λ4-sulfanyl]butanoic acid (CID 141485997) is (2R)-2-(3-chloro-5-fluoroanilino)-4-[iodo(dimethyl)-λ4-sulfanyl]butanoic acid.
What is the SMILES notation for (2R)-2-(3-chloro-5-fluoroanilino)-4-[iodo(dimethyl)-λ4-sulfanyl]butanoic acid?
The canonical SMILES for (2R)-2-(3-chloro-5-fluoroanilino)-4-[iodo(dimethyl)-λ4-sulfanyl]butanoic acid is CS(C)(I)CC[C@@H](Nc1cc(F)cc(Cl)c1)C(=O)O.
What is the InChIKey of (2R)-2-(3-chloro-5-fluoroanilino)-4-[iodo(dimethyl)-λ4-sulfanyl]butanoic acid?
The InChIKey is QABROOWLWNNCKQ-LLVKDONJSA-N. The full InChI is InChI=1S/C12H16ClFINO2S/c1-19(2,15)4-3-11(12(17)18)16-10-6-8(13)5-9(14)7-10/h5-7,11,16H,3-4H2,1-2H3,(H,17,18)/t11-/m1/s1.
What are the key properties of (2R)-2-(3-chloro-5-fluoroanilino)-4-[iodo(dimethyl)-λ4-sulfanyl]butanoic acid?
(2R)-2-(3-chloro-5-fluoroanilino)-4-[iodo(dimethyl)-λ4-sulfanyl]butanoic acid has a molecular weight of 419.69 g/mol, XLogP of 4.15, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(3-chloro-5-fluoroanilino)-4-[iodo(dimethyl)-λ4-sulfanyl]butanoic acid is sourced from PubChem (CID 141485997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).