C19H29NOS — CID 141486184
(1R,2R,3R,5S)-N-[(3-cyclopropyl-5-methoxythiophen-2-yl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine (PubChem CID 141486184) has the molecular formula C19H29NOS and a molecular weight of 319.51 g/mol. Its IUPAC name is (1R,2R,3R,5S)-N-[(3-cyclopropyl-5-methoxythiophen-2-yl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine.
| Compound Name | (1R,2R,3R,5S)-N-[(3-cyclopropyl-5-methoxythiophen-2-yl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine |
|---|---|
| PubChem CID | 141486184 |
| Molecular Formula | C19H29NOS |
| Molecular Weight | 319.51 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | (1R,2R,3R,5S)-N-[(3-cyclopropyl-5-methoxythiophen-2-yl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine |
| SMILES | COc1cc(C2CC2)c(CN[C@@H]2C[C@@H]3C[C@H]([C@H]2C)C3(C)C)s1 |
| InChI | InChI=1S/C19H29NOS/c1-11-15-7-13(19(15,2)3)8-16(11)20-10-17-14(12-5-6-12)9-18(21-4)22-17/h9,11-13,15-16,20H,5-8,10H2,1-4H3/t11-,13+,15-,16-/m1/s1 |
| InChIKey | PAKKMBVRORZIGJ-WXYCVUISSA-N |
| XLogP | 4.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |