C19H30ClNO2S2 — CID 141486185
(1R,2R,3R,5S)-N-[(3-cyclopropyl-5-methylsulfonylthiophen-2-yl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine;hydrochloride (PubChem CID 141486185) has the molecular formula C19H30ClNO2S2 and a molecular weight of 404.04 g/mol. Its IUPAC name is (1R,2R,3R,5S)-N-[(3-cyclopropyl-5-methylsulfonylthiophen-2-yl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine;hydrochloride.
| Compound Name | (1R,2R,3R,5S)-N-[(3-cyclopropyl-5-methylsulfonylthiophen-2-yl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine;hydrochloride |
|---|---|
| PubChem CID | 141486185 |
| Molecular Formula | C19H30ClNO2S2 |
| Molecular Weight | 404.04 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | (1R,2R,3R,5S)-N-[(3-cyclopropyl-5-methylsulfonylthiophen-2-yl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine;hydrochloride |
| SMILES | C[C@@H]1[C@H]2C[C@@H](C[C@H]1NCc1sc(S(C)(=O)=O)cc1C1CC1)C2(C)C.Cl |
| InChI | InChI=1S/C19H29NO2S2.ClH/c1-11-15-7-13(19(15,2)3)8-16(11)20-10-17-14(12-5-6-12)9-18(23-17)24(4,21)22;/h9,11-13,15-16,20H,5-8,10H2,1-4H3;1H/t11-,13+,15-,16-;/m1./s1 |
| InChIKey | PJUVFZADWRELKU-GZEIEDQUSA-N |
| XLogP | 4.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.04 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |