About 4-chloro-3-[(3R,4S)-3-methoxyoxan-4-yl]sulfonylaniline
4-chloro-3-[(3R,4S)-3-methoxyoxan-4-yl]sulfonylaniline (PubChem CID 141486480) has the molecular formula C12H16ClNO4S
and a molecular weight of 305.78 g/mol. Its IUPAC name is 4-chloro-3-[(3R,4S)-3-methoxyoxan-4-yl]sulfonylaniline.
Molecular Properties
| Compound Name | 4-chloro-3-[(3R,4S)-3-methoxyoxan-4-yl]sulfonylaniline |
| PubChem CID | 141486480 |
| Molecular Formula | C12H16ClNO4S |
| Molecular Weight | 305.78 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 4-chloro-3-[(3R,4S)-3-methoxyoxan-4-yl]sulfonylaniline |
| SMILES | CO[C@@H]1COCC[C@@H]1S(=O)(=O)c1cc(N)ccc1Cl |
| InChI | InChI=1S/C12H16ClNO4S/c1-17-10-7-18-5-4-11(10)19(15,16)12-6-8(14)2-3-9(12)13/h2-3,6,10-11H,4-5,7,14H2,1H3/t10-,11+/m1/s1 |
| InChIKey | AMMXJUXNUWMBRR-MNOVXSKESA-N |
| XLogP | 1.50 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.78 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-[(3R,4S)-3-methoxyoxan-4-yl]sulfonylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-[(3R,4S)-3-methoxyoxan-4-yl]sulfonylaniline?
The IUPAC name of 4-chloro-3-[(3R,4S)-3-methoxyoxan-4-yl]sulfonylaniline (CID 141486480) is 4-chloro-3-[(3R,4S)-3-methoxyoxan-4-yl]sulfonylaniline.
What is the SMILES notation for 4-chloro-3-[(3R,4S)-3-methoxyoxan-4-yl]sulfonylaniline?
The canonical SMILES for 4-chloro-3-[(3R,4S)-3-methoxyoxan-4-yl]sulfonylaniline is CO[C@@H]1COCC[C@@H]1S(=O)(=O)c1cc(N)ccc1Cl.
What is the InChIKey of 4-chloro-3-[(3R,4S)-3-methoxyoxan-4-yl]sulfonylaniline?
The InChIKey is AMMXJUXNUWMBRR-MNOVXSKESA-N. The full InChI is InChI=1S/C12H16ClNO4S/c1-17-10-7-18-5-4-11(10)19(15,16)12-6-8(14)2-3-9(12)13/h2-3,6,10-11H,4-5,7,14H2,1H3/t10-,11+/m1/s1.
What are the key properties of 4-chloro-3-[(3R,4S)-3-methoxyoxan-4-yl]sulfonylaniline?
4-chloro-3-[(3R,4S)-3-methoxyoxan-4-yl]sulfonylaniline has a molecular weight of 305.78 g/mol, XLogP of 1.50, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-[(3R,4S)-3-methoxyoxan-4-yl]sulfonylaniline is sourced from PubChem (CID 141486480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).