About 3-(2-sulfanyl-1,3-benzodioxol-5-yl)propanenitrile
3-(2-sulfanyl-1,3-benzodioxol-5-yl)propanenitrile (PubChem CID 141486746) has the molecular formula C10H9NO2S
and a molecular weight of 207.25 g/mol. Its IUPAC name is 3-(2-sulfanyl-1,3-benzodioxol-5-yl)propanenitrile.
Molecular Properties
| Compound Name | 3-(2-sulfanyl-1,3-benzodioxol-5-yl)propanenitrile |
| PubChem CID | 141486746 |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 3-(2-sulfanyl-1,3-benzodioxol-5-yl)propanenitrile |
| SMILES | N#CCCc1ccc2c(c1)OC(S)O2 |
| InChI | InChI=1S/C10H9NO2S/c11-5-1-2-7-3-4-8-9(6-7)13-10(14)12-8/h3-4,6,10,14H,1-2H2 |
| InChIKey | NKCAXTRDMOIEDB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 42.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-sulfanyl-1,3-benzodioxol-5-yl)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-sulfanyl-1,3-benzodioxol-5-yl)propanenitrile?
The IUPAC name of 3-(2-sulfanyl-1,3-benzodioxol-5-yl)propanenitrile (CID 141486746) is 3-(2-sulfanyl-1,3-benzodioxol-5-yl)propanenitrile.
What is the SMILES notation for 3-(2-sulfanyl-1,3-benzodioxol-5-yl)propanenitrile?
The canonical SMILES for 3-(2-sulfanyl-1,3-benzodioxol-5-yl)propanenitrile is N#CCCc1ccc2c(c1)OC(S)O2.
What is the InChIKey of 3-(2-sulfanyl-1,3-benzodioxol-5-yl)propanenitrile?
The InChIKey is NKCAXTRDMOIEDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2S/c11-5-1-2-7-3-4-8-9(6-7)13-10(14)12-8/h3-4,6,10,14H,1-2H2.
What are the key properties of 3-(2-sulfanyl-1,3-benzodioxol-5-yl)propanenitrile?
3-(2-sulfanyl-1,3-benzodioxol-5-yl)propanenitrile has a molecular weight of 207.25 g/mol, XLogP of 2.13, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-sulfanyl-1,3-benzodioxol-5-yl)propanenitrile is sourced from PubChem (CID 141486746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).