C15H9F3N2OSe — CID 141487087
2-phenylselanyl-5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazole (PubChem CID 141487087) has the molecular formula C15H9F3N2OSe and a molecular weight of 369.20 g/mol. Its IUPAC name is 2-phenylselanyl-5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazole.
| Compound Name | 2-phenylselanyl-5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 141487087 |
| Molecular Formula | C15H9F3N2OSe |
| Molecular Weight | 369.20 g/mol |
| Exact Mass | 369.98 |
| IUPAC Name | 2-phenylselanyl-5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazole |
| SMILES | FC(F)(F)c1ccc(-c2nnc([Se]c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C15H9F3N2OSe/c16-15(17,18)11-8-6-10(7-9-11)13-19-20-14(21-13)22-12-4-2-1-3-5-12/h1-9H |
| InChIKey | IGHWBDHCQNTODF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.20 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|