C13H16O2 — CID 141487272
(E)-4-oxo-4-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)but-2-enal (PubChem CID 141487272) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is (E)-4-oxo-4-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)but-2-enal.
| Compound Name | (E)-4-oxo-4-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)but-2-enal |
|---|---|
| PubChem CID | 141487272 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (E)-4-oxo-4-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)but-2-enal |
| SMILES | CC1=C(C(=O)/C=C/C=O)C(C)(C)CC=C1 |
| InChI | InChI=1S/C13H16O2/c1-10-6-4-8-13(2,3)12(10)11(15)7-5-9-14/h4-7,9H,8H2,1-3H3/b7-5+ |
| InChIKey | MUEMLMUNLKLOSJ-FNORWQNLSA-N |
| XLogP | 2.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|