C21H28N3NaO2S — CID 141487529
sodium 4-[cyclopropyl-(3,4,4,7,7-pentamethyl-5,6-dihydro-1-benzothiophen-2-yl)amino]-2H-pyrimidine-1-carboxylate (PubChem CID 141487529) has the molecular formula C21H28N3NaO2S and a molecular weight of 409.53 g/mol. Its IUPAC name is sodium 4-[cyclopropyl-(3,4,4,7,7-pentamethyl-5,6-dihydro-1-benzothiophen-2-yl)amino]-2H-pyrimidine-1-carboxylate.
| Compound Name | sodium 4-[cyclopropyl-(3,4,4,7,7-pentamethyl-5,6-dihydro-1-benzothiophen-2-yl)amino]-2H-pyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 141487529 |
| Molecular Formula | C21H28N3NaO2S |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | sodium 4-[cyclopropyl-(3,4,4,7,7-pentamethyl-5,6-dihydro-1-benzothiophen-2-yl)amino]-2H-pyrimidine-1-carboxylate |
| SMILES | Cc1c(N(C2=NCN(C(=O)[O-])C=C2)C2CC2)sc2c1C(C)(C)CCC2(C)C.[Na+] |
| InChI | InChI=1S/C21H29N3O2S.Na/c1-13-16-17(21(4,5)10-9-20(16,2)3)27-18(13)24(14-6-7-14)15-8-11-23(12-22-15)19(25)26;/h8,11,14H,6-7,9-10,12H2,1-5H3,(H,25,26);/q;+1/p-1 |
| InChIKey | YLSHJPCTYNCOMI-UHFFFAOYSA-M |
| XLogP | 0.91 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |