C23H21FN8O — CID 141487614
N-[2-(N'-benzylcarbamimidoyl)-5-fluoro-4-pyridinyl]-1-methyl-4-(2-methylpyrimidin-4-yl)pyrazole-5-carboxamide (PubChem CID 141487614) has the molecular formula C23H21FN8O and a molecular weight of 444.47 g/mol. Its IUPAC name is N-[2-(N'-benzylcarbamimidoyl)-5-fluoro-4-pyridinyl]-1-methyl-4-(2-methylpyrimidin-4-yl)pyrazole-5-carboxamide.
| Compound Name | N-[2-(N'-benzylcarbamimidoyl)-5-fluoro-4-pyridinyl]-1-methyl-4-(2-methylpyrimidin-4-yl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 141487614 |
| Molecular Formula | C23H21FN8O |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | N-[2-(N'-benzylcarbamimidoyl)-5-fluoro-4-pyridinyl]-1-methyl-4-(2-methylpyrimidin-4-yl)pyrazole-5-carboxamide |
| SMILES | Cc1nccc(-c2cnn(C)c2C(=O)Nc2cc(/C(N)=N/Cc3ccccc3)ncc2F)n1 |
| InChI | InChI=1S/C23H21FN8O/c1-14-26-9-8-18(30-14)16-12-29-32(2)21(16)23(33)31-19-10-20(27-13-17(19)24)22(25)28-11-15-6-4-3-5-7-15/h3-10,12-13H,11H2,1-2H3,(H2,25,28)(H,27,31,33) |
| InChIKey | ZBXFPXMZTUHHJD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 123.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|