C26H33F2N5O — CID 141487718
2-[4-[3-[3,5-difluoro-4-(5-propan-2-yl-1H-pyrazol-3-yl)phenoxy]propyl]piperidin-1-yl]-5-ethylpyrimidine (PubChem CID 141487718) has the molecular formula C26H33F2N5O and a molecular weight of 469.58 g/mol. Its IUPAC name is 2-[4-[3-[3,5-difluoro-4-(5-propan-2-yl-1H-pyrazol-3-yl)phenoxy]propyl]piperidin-1-yl]-5-ethylpyrimidine.
| Compound Name | 2-[4-[3-[3,5-difluoro-4-(5-propan-2-yl-1H-pyrazol-3-yl)phenoxy]propyl]piperidin-1-yl]-5-ethylpyrimidine |
|---|---|
| PubChem CID | 141487718 |
| Molecular Formula | C26H33F2N5O |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | 2-[4-[3-[3,5-difluoro-4-(5-propan-2-yl-1H-pyrazol-3-yl)phenoxy]propyl]piperidin-1-yl]-5-ethylpyrimidine |
| SMILES | CCc1cnc(N2CCC(CCCOc3cc(F)c(-c4cc(C(C)C)[nH]n4)c(F)c3)CC2)nc1 |
| InChI | InChI=1S/C26H33F2N5O/c1-4-18-15-29-26(30-16-18)33-9-7-19(8-10-33)6-5-11-34-20-12-21(27)25(22(28)13-20)24-14-23(17(2)3)31-32-24/h12-17,19H,4-11H2,1-3H3,(H,31,32) |
| InChIKey | UDEBRPKRCMHCBV-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|