C29H39F2N5O — CID 141487769
2-[4-[3-[3,5-difluoro-4-(5-propan-2-yl-1H-pyrazol-3-yl)phenoxy]propyl]piperidin-1-yl]-5-pentylpyrimidine (PubChem CID 141487769) has the molecular formula C29H39F2N5O and a molecular weight of 511.66 g/mol. Its IUPAC name is 2-[4-[3-[3,5-difluoro-4-(5-propan-2-yl-1H-pyrazol-3-yl)phenoxy]propyl]piperidin-1-yl]-5-pentylpyrimidine.
| Compound Name | 2-[4-[3-[3,5-difluoro-4-(5-propan-2-yl-1H-pyrazol-3-yl)phenoxy]propyl]piperidin-1-yl]-5-pentylpyrimidine |
|---|---|
| PubChem CID | 141487769 |
| Molecular Formula | C29H39F2N5O |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.31 |
| IUPAC Name | 2-[4-[3-[3,5-difluoro-4-(5-propan-2-yl-1H-pyrazol-3-yl)phenoxy]propyl]piperidin-1-yl]-5-pentylpyrimidine |
| SMILES | CCCCCc1cnc(N2CCC(CCCOc3cc(F)c(-c4cc(C(C)C)[nH]n4)c(F)c3)CC2)nc1 |
| InChI | InChI=1S/C29H39F2N5O/c1-4-5-6-8-22-18-32-29(33-19-22)36-12-10-21(11-13-36)9-7-14-37-23-15-24(30)28(25(31)16-23)27-17-26(20(2)3)34-35-27/h15-21H,4-14H2,1-3H3,(H,34,35) |
| InChIKey | VTDOJHKWEALRSO-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|