About 3-chloro-7-[(2S,4R)-2-methylpiperidin-4-yl]-4H-pyrazolo[1,5-a]pyrimidin-5-one
3-chloro-7-[(2S,4R)-2-methylpiperidin-4-yl]-4H-pyrazolo[1,5-a]pyrimidin-5-one (PubChem CID 141489215) has the molecular formula C12H15ClN4O
and a molecular weight of 266.73 g/mol. Its IUPAC name is 3-chloro-7-[(2S,4R)-2-methylpiperidin-4-yl]-4H-pyrazolo[1,5-a]pyrimidin-5-one.
Molecular Properties
| Compound Name | 3-chloro-7-[(2S,4R)-2-methylpiperidin-4-yl]-4H-pyrazolo[1,5-a]pyrimidin-5-one |
| PubChem CID | 141489215 |
| Molecular Formula | C12H15ClN4O |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 3-chloro-7-[(2S,4R)-2-methylpiperidin-4-yl]-4H-pyrazolo[1,5-a]pyrimidin-5-one |
| SMILES | C[C@H]1C[C@H](c2cc(=O)[nH]c3c(Cl)cnn23)CCN1 |
| InChI | InChI=1S/C12H15ClN4O/c1-7-4-8(2-3-14-7)10-5-11(18)16-12-9(13)6-15-17(10)12/h5-8,14H,2-4H2,1H3,(H,16,18)/t7-,8+/m0/s1 |
| InChIKey | GOQLTCPCGBVLFY-JGVFFNPUSA-N |
| XLogP | 1.53 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-7-[(2S,4R)-2-methylpiperidin-4-yl]-4H-pyrazolo[1,5-a]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-7-[(2S,4R)-2-methylpiperidin-4-yl]-4H-pyrazolo[1,5-a]pyrimidin-5-one?
The IUPAC name of 3-chloro-7-[(2S,4R)-2-methylpiperidin-4-yl]-4H-pyrazolo[1,5-a]pyrimidin-5-one (CID 141489215) is 3-chloro-7-[(2S,4R)-2-methylpiperidin-4-yl]-4H-pyrazolo[1,5-a]pyrimidin-5-one.
What is the SMILES notation for 3-chloro-7-[(2S,4R)-2-methylpiperidin-4-yl]-4H-pyrazolo[1,5-a]pyrimidin-5-one?
The canonical SMILES for 3-chloro-7-[(2S,4R)-2-methylpiperidin-4-yl]-4H-pyrazolo[1,5-a]pyrimidin-5-one is C[C@H]1C[C@H](c2cc(=O)[nH]c3c(Cl)cnn23)CCN1.
What is the InChIKey of 3-chloro-7-[(2S,4R)-2-methylpiperidin-4-yl]-4H-pyrazolo[1,5-a]pyrimidin-5-one?
The InChIKey is GOQLTCPCGBVLFY-JGVFFNPUSA-N. The full InChI is InChI=1S/C12H15ClN4O/c1-7-4-8(2-3-14-7)10-5-11(18)16-12-9(13)6-15-17(10)12/h5-8,14H,2-4H2,1H3,(H,16,18)/t7-,8+/m0/s1.
What are the key properties of 3-chloro-7-[(2S,4R)-2-methylpiperidin-4-yl]-4H-pyrazolo[1,5-a]pyrimidin-5-one?
3-chloro-7-[(2S,4R)-2-methylpiperidin-4-yl]-4H-pyrazolo[1,5-a]pyrimidin-5-one has a molecular weight of 266.73 g/mol, XLogP of 1.53, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-7-[(2S,4R)-2-methylpiperidin-4-yl]-4H-pyrazolo[1,5-a]pyrimidin-5-one is sourced from PubChem (CID 141489215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).