About (1,3-dimethylpyrazolo[4,5-b]pyridin-6-yl)boronic acid
(1,3-dimethylpyrazolo[4,5-b]pyridin-6-yl)boronic acid (PubChem CID 141489391) has the molecular formula C8H10BN3O2
and a molecular weight of 191.00 g/mol. Its IUPAC name is (1,3-dimethylpyrazolo[4,5-b]pyridin-6-yl)boronic acid.
Molecular Properties
| Compound Name | (1,3-dimethylpyrazolo[4,5-b]pyridin-6-yl)boronic acid |
| PubChem CID | 141489391 |
| Molecular Formula | C8H10BN3O2 |
| Molecular Weight | 191.00 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (1,3-dimethylpyrazolo[4,5-b]pyridin-6-yl)boronic acid |
| SMILES | Cc1nn(C)c2cc(B(O)O)cnc12 |
| InChI | InChI=1S/C8H10BN3O2/c1-5-8-7(12(2)11-5)3-6(4-10-8)9(13)14/h3-4,13-14H,1-2H3 |
| InChIKey | MGGRAQNRTQOUFS-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.00 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (1,3-dimethylpyrazolo[4,5-b]pyridin-6-yl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,3-dimethylpyrazolo[4,5-b]pyridin-6-yl)boronic acid?
The IUPAC name of (1,3-dimethylpyrazolo[4,5-b]pyridin-6-yl)boronic acid (CID 141489391) is (1,3-dimethylpyrazolo[4,5-b]pyridin-6-yl)boronic acid.
What is the SMILES notation for (1,3-dimethylpyrazolo[4,5-b]pyridin-6-yl)boronic acid?
The canonical SMILES for (1,3-dimethylpyrazolo[4,5-b]pyridin-6-yl)boronic acid is Cc1nn(C)c2cc(B(O)O)cnc12.
What is the InChIKey of (1,3-dimethylpyrazolo[4,5-b]pyridin-6-yl)boronic acid?
The InChIKey is MGGRAQNRTQOUFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BN3O2/c1-5-8-7(12(2)11-5)3-6(4-10-8)9(13)14/h3-4,13-14H,1-2H3.
What are the key properties of (1,3-dimethylpyrazolo[4,5-b]pyridin-6-yl)boronic acid?
(1,3-dimethylpyrazolo[4,5-b]pyridin-6-yl)boronic acid has a molecular weight of 191.00 g/mol, XLogP of -1.04, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dimethylpyrazolo[4,5-b]pyridin-6-yl)boronic acid is sourced from PubChem (CID 141489391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).