C21H33BN4O2 — CID 141489393
1-methyl-3-[2-(4-methylpiperazin-1-yl)ethyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 141489393) has the molecular formula C21H33BN4O2 and a molecular weight of 384.33 g/mol. Its IUPAC name is 1-methyl-3-[2-(4-methylpiperazin-1-yl)ethyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 1-methyl-3-[2-(4-methylpiperazin-1-yl)ethyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 141489393 |
| Molecular Formula | C21H33BN4O2 |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | 1-methyl-3-[2-(4-methylpiperazin-1-yl)ethyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | CN1CCN(CCc2nn(C)c3cc(B4OC(C)(C)C(C)(C)O4)ccc23)CC1 |
| InChI | InChI=1S/C21H33BN4O2/c1-20(2)21(3,4)28-22(27-20)16-7-8-17-18(23-25(6)19(17)15-16)9-10-26-13-11-24(5)12-14-26/h7-8,15H,9-14H2,1-6H3 |
| InChIKey | PCLWWWXVZHIHIR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 42.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|