C14H20BN3O2 — CID 141489394
1,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[4,5-b]pyridine (PubChem CID 141489394) has the molecular formula C14H20BN3O2 and a molecular weight of 273.14 g/mol. Its IUPAC name is 1,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[4,5-b]pyridine.
| Compound Name | 1,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 141489394 |
| Molecular Formula | C14H20BN3O2 |
| Molecular Weight | 273.14 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 1,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[4,5-b]pyridine |
| SMILES | Cc1nn(C)c2cc(B3OC(C)(C)C(C)(C)O3)cnc12 |
| InChI | InChI=1S/C14H20BN3O2/c1-9-12-11(18(6)17-9)7-10(8-16-12)15-19-13(2,3)14(4,5)20-15/h7-8H,1-6H3 |
| InChIKey | IHQUMFLAMSIDRL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.14 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|