C18H19N — CID 141490789
1-(2-methyl-1H-inden-4-yl)-2,3,3a,4-tetrahydroindole (PubChem CID 141490789) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-(2-methyl-1H-inden-4-yl)-2,3,3a,4-tetrahydroindole.
| Compound Name | 1-(2-methyl-1H-inden-4-yl)-2,3,3a,4-tetrahydroindole |
|---|---|
| PubChem CID | 141490789 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 1-(2-methyl-1H-inden-4-yl)-2,3,3a,4-tetrahydroindole |
| SMILES | CC1=Cc2c(cccc2N2CCC3CC=CC=C32)C1 |
| InChI | InChI=1S/C18H19N/c1-13-11-15-6-4-8-18(16(15)12-13)19-10-9-14-5-2-3-7-17(14)19/h2-4,6-8,12,14H,5,9-11H2,1H3 |
| InChIKey | DYBNQQLSFJVLBD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |