About 1-benzyl-6-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]benzimidazol-2-amine
1-benzyl-6-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]benzimidazol-2-amine (PubChem CID 141490971) has the molecular formula C25H18FN5O
and a molecular weight of 423.45 g/mol. Its IUPAC name is 1-benzyl-6-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]benzimidazol-2-amine.
Molecular Properties
| Compound Name | 1-benzyl-6-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]benzimidazol-2-amine |
| PubChem CID | 141490971 |
| Molecular Formula | C25H18FN5O |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 1-benzyl-6-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]benzimidazol-2-amine |
| SMILES | Nc1nc2ccc(-c3c(-c4ccc(F)cc4)nc4occn34)cc2n1Cc1ccccc1 |
| InChI | InChI=1S/C25H18FN5O/c26-19-9-6-17(7-10-19)22-23(30-12-13-32-25(30)29-22)18-8-11-20-21(14-18)31(24(27)28-20)15-16-4-2-1-3-5-16/h1-14H,15H2,(H2,27,28) |
| InChIKey | ZZSVFKOXGXREQG-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 74.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-benzyl-6-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]benzimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-6-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]benzimidazol-2-amine?
The IUPAC name of 1-benzyl-6-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]benzimidazol-2-amine (CID 141490971) is 1-benzyl-6-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]benzimidazol-2-amine.
What is the SMILES notation for 1-benzyl-6-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]benzimidazol-2-amine?
The canonical SMILES for 1-benzyl-6-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]benzimidazol-2-amine is Nc1nc2ccc(-c3c(-c4ccc(F)cc4)nc4occn34)cc2n1Cc1ccccc1.
What is the InChIKey of 1-benzyl-6-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]benzimidazol-2-amine?
The InChIKey is ZZSVFKOXGXREQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H18FN5O/c26-19-9-6-17(7-10-19)22-23(30-12-13-32-25(30)29-22)18-8-11-20-21(14-18)31(24(27)28-20)15-16-4-2-1-3-5-16/h1-14H,15H2,(H2,27,28).
What are the key properties of 1-benzyl-6-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]benzimidazol-2-amine?
1-benzyl-6-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]benzimidazol-2-amine has a molecular weight of 423.45 g/mol, XLogP of 5.38, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-6-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]benzimidazol-2-amine is sourced from PubChem (CID 141490971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).