C10H10BrFO — CID 141491130
5-bromo-6-fluoro-3-methyl-2,3,4,5-tetrahydroinden-1-one (PubChem CID 141491130) has the molecular formula C10H10BrFO and a molecular weight of 245.09 g/mol. Its IUPAC name is 5-bromo-6-fluoro-3-methyl-2,3,4,5-tetrahydroinden-1-one.
| Compound Name | 5-bromo-6-fluoro-3-methyl-2,3,4,5-tetrahydroinden-1-one |
|---|---|
| PubChem CID | 141491130 |
| Molecular Formula | C10H10BrFO |
| Molecular Weight | 245.09 g/mol |
| Exact Mass | 243.99 |
| IUPAC Name | 5-bromo-6-fluoro-3-methyl-2,3,4,5-tetrahydroinden-1-one |
| SMILES | CC1CC(=O)C2=C1CC(Br)C(F)=C2 |
| InChI | InChI=1S/C10H10BrFO/c1-5-2-10(13)7-4-9(12)8(11)3-6(5)7/h4-5,8H,2-3H2,1H3 |
| InChIKey | FRBIPEAQKVUIAB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.09 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|