C12H18O3 — CID 14149173
6-tert-butyl-1,4-dioxaspiro[4.5]dec-9-en-8-one (PubChem CID 14149173) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 6-tert-butyl-1,4-dioxaspiro[4.5]dec-9-en-8-one.
| Compound Name | 6-tert-butyl-1,4-dioxaspiro[4.5]dec-9-en-8-one |
|---|---|
| PubChem CID | 14149173 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 6-tert-butyl-1,4-dioxaspiro[4.5]dec-9-en-8-one |
| SMILES | CC(C)(C)C1CC(=O)C=CC12OCCO2 |
| InChI | InChI=1S/C12H18O3/c1-11(2,3)10-8-9(13)4-5-12(10)14-6-7-15-12/h4-5,10H,6-8H2,1-3H3 |
| InChIKey | UWTVNVORNAOZFI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |