C19H39F4NO3S — CID 141492644
tetraethylazanium;1,11,11,11-tetrafluoroundecane-1-sulfonate (PubChem CID 141492644) has the molecular formula C19H39F4NO3S and a molecular weight of 437.58 g/mol. Its IUPAC name is tetraethylazanium;1,11,11,11-tetrafluoroundecane-1-sulfonate.
| Compound Name | tetraethylazanium;1,11,11,11-tetrafluoroundecane-1-sulfonate |
|---|---|
| PubChem CID | 141492644 |
| Molecular Formula | C19H39F4NO3S |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | tetraethylazanium;1,11,11,11-tetrafluoroundecane-1-sulfonate |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])C(F)CCCCCCCCCC(F)(F)F |
| InChI | InChI=1S/C11H20F4O3S.C8H20N/c12-10(19(16,17)18)8-6-4-2-1-3-5-7-9-11(13,14)15;1-5-9(6-2,7-3)8-4/h10H,1-9H2,(H,16,17,18);5-8H2,1-4H3/q;+1/p-1 |
| InChIKey | IAXCOKUSAMYQMU-UHFFFAOYSA-M |
| XLogP | 5.78 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|