C29H28N4O2S — CID 141492948
2-[5-(3,4-dimethoxyphenyl)pyrimidin-2-yl]-1-(5-ethylthiophen-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 141492948) has the molecular formula C29H28N4O2S and a molecular weight of 496.64 g/mol. Its IUPAC name is 2-[5-(3,4-dimethoxyphenyl)pyrimidin-2-yl]-1-(5-ethylthiophen-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-[5-(3,4-dimethoxyphenyl)pyrimidin-2-yl]-1-(5-ethylthiophen-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 141492948 |
| Molecular Formula | C29H28N4O2S |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 2-[5-(3,4-dimethoxyphenyl)pyrimidin-2-yl]-1-(5-ethylthiophen-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CCc1ccc(C2c3[nH]c4ccccc4c3CCN2c2ncc(-c3ccc(OC)c(OC)c3)cn2)s1 |
| InChI | InChI=1S/C29H28N4O2S/c1-4-20-10-12-26(36-20)28-27-22(21-7-5-6-8-23(21)32-27)13-14-33(28)29-30-16-19(17-31-29)18-9-11-24(34-2)25(15-18)35-3/h5-12,15-17,28,32H,4,13-14H2,1-3H3 |
| InChIKey | VLAHBXYOJSVMCU-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|