C21H19ClN4S — CID 141492987
6-chloro-1-(5-ethylthiophen-2-yl)-2-pyrimidin-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 141492987) has the molecular formula C21H19ClN4S and a molecular weight of 394.93 g/mol. Its IUPAC name is 6-chloro-1-(5-ethylthiophen-2-yl)-2-pyrimidin-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 6-chloro-1-(5-ethylthiophen-2-yl)-2-pyrimidin-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 141492987 |
| Molecular Formula | C21H19ClN4S |
| Molecular Weight | 394.93 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 6-chloro-1-(5-ethylthiophen-2-yl)-2-pyrimidin-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CCc1ccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2c2ncccn2)s1 |
| InChI | InChI=1S/C21H19ClN4S/c1-2-14-5-7-18(27-14)20-19-15(16-12-13(22)4-6-17(16)25-19)8-11-26(20)21-23-9-3-10-24-21/h3-7,9-10,12,20,25H,2,8,11H2,1H3 |
| InChIKey | MKHCRNKWUDJXSL-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.93 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|