About 3-bromo-2-methyl-9H-pyrido[2,3-b]indole
3-bromo-2-methyl-9H-pyrido[2,3-b]indole (PubChem CID 141493017) has the molecular formula C12H9BrN2
and a molecular weight of 261.12 g/mol. Its IUPAC name is 3-bromo-2-methyl-9H-pyrido[2,3-b]indole.
Molecular Properties
| Compound Name | 3-bromo-2-methyl-9H-pyrido[2,3-b]indole |
| PubChem CID | 141493017 |
| Molecular Formula | C12H9BrN2 |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | 3-bromo-2-methyl-9H-pyrido[2,3-b]indole |
| SMILES | Cc1nc2[nH]c3ccccc3c2cc1Br |
| InChI | InChI=1S/C12H9BrN2/c1-7-10(13)6-9-8-4-2-3-5-11(8)15-12(9)14-7/h2-6H,1H3,(H,14,15) |
| InChIKey | JSVSVXSBNKRFHJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-bromo-2-methyl-9H-pyrido[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-methyl-9H-pyrido[2,3-b]indole?
The IUPAC name of 3-bromo-2-methyl-9H-pyrido[2,3-b]indole (CID 141493017) is 3-bromo-2-methyl-9H-pyrido[2,3-b]indole.
What is the SMILES notation for 3-bromo-2-methyl-9H-pyrido[2,3-b]indole?
The canonical SMILES for 3-bromo-2-methyl-9H-pyrido[2,3-b]indole is Cc1nc2[nH]c3ccccc3c2cc1Br.
What is the InChIKey of 3-bromo-2-methyl-9H-pyrido[2,3-b]indole?
The InChIKey is JSVSVXSBNKRFHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BrN2/c1-7-10(13)6-9-8-4-2-3-5-11(8)15-12(9)14-7/h2-6H,1H3,(H,14,15).
What are the key properties of 3-bromo-2-methyl-9H-pyrido[2,3-b]indole?
3-bromo-2-methyl-9H-pyrido[2,3-b]indole has a molecular weight of 261.12 g/mol, XLogP of 3.79, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-methyl-9H-pyrido[2,3-b]indole is sourced from PubChem (CID 141493017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).