C12H22O4Si — CID 141493039
(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclopentene-1-carboxylic acid (PubChem CID 141493039) has the molecular formula C12H22O4Si and a molecular weight of 258.39 g/mol. Its IUPAC name is (3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclopentene-1-carboxylic acid.
| Compound Name | (3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclopentene-1-carboxylic acid |
|---|---|
| PubChem CID | 141493039 |
| Molecular Formula | C12H22O4Si |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | (3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclopentene-1-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C=C(C(=O)O)[C@H](O)C1 |
| InChI | InChI=1S/C12H22O4Si/c1-12(2,3)17(4,5)16-8-6-9(11(14)15)10(13)7-8/h6,8,10,13H,7H2,1-5H3,(H,14,15)/t8-,10-/m1/s1 |
| InChIKey | OGRUXUCCBMXYRG-PSASIEDQSA-N |
| XLogP | 2.15 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|