C15H17N3O3 — CID 141493623
1-(formamidomethoxy)-2,3,4,9-tetrahydrocarbazole-1-carboxamide (PubChem CID 141493623) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 1-(formamidomethoxy)-2,3,4,9-tetrahydrocarbazole-1-carboxamide.
| Compound Name | 1-(formamidomethoxy)-2,3,4,9-tetrahydrocarbazole-1-carboxamide |
|---|---|
| PubChem CID | 141493623 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 1-(formamidomethoxy)-2,3,4,9-tetrahydrocarbazole-1-carboxamide |
| SMILES | NC(=O)C1(OCNC=O)CCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C15H17N3O3/c16-14(20)15(21-9-17-8-19)7-3-5-11-10-4-1-2-6-12(10)18-13(11)15/h1-2,4,6,8,18H,3,5,7,9H2,(H2,16,20)(H,17,19) |
| InChIKey | TWLBGUCJDAZGHO-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|