C14H25N — CID 141493771
1,6-dimethyl-N,N-dipropylcyclohexa-2,4-dien-1-amine (PubChem CID 141493771) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is 1,6-dimethyl-N,N-dipropylcyclohexa-2,4-dien-1-amine.
| Compound Name | 1,6-dimethyl-N,N-dipropylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 141493771 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 1,6-dimethyl-N,N-dipropylcyclohexa-2,4-dien-1-amine |
| SMILES | CCCN(CCC)C1(C)C=CC=CC1C |
| InChI | InChI=1S/C14H25N/c1-5-11-15(12-6-2)14(4)10-8-7-9-13(14)3/h7-10,13H,5-6,11-12H2,1-4H3 |
| InChIKey | MBFCHQNBGKWMBO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |