About 1-[benzyl-(3,3-dimethyl-2-oxobutyl)amino]-3,3-dimethylbutan-2-one
1-[benzyl-(3,3-dimethyl-2-oxobutyl)amino]-3,3-dimethylbutan-2-one (PubChem CID 14149398) has the molecular formula C19H29NO2
and a molecular weight of 303.45 g/mol. Its IUPAC name is 1-[benzyl-(3,3-dimethyl-2-oxobutyl)amino]-3,3-dimethylbutan-2-one.
Molecular Properties
| Compound Name | 1-[benzyl-(3,3-dimethyl-2-oxobutyl)amino]-3,3-dimethylbutan-2-one |
| PubChem CID | 14149398 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | 1-[benzyl-(3,3-dimethyl-2-oxobutyl)amino]-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)C(=O)CN(CC(=O)C(C)(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C19H29NO2/c1-18(2,3)16(21)13-20(14-17(22)19(4,5)6)12-15-10-8-7-9-11-15/h7-11H,12-14H2,1-6H3 |
| InChIKey | UATQWWAGLNQRRN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[benzyl-(3,3-dimethyl-2-oxobutyl)amino]-3,3-dimethylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[benzyl-(3,3-dimethyl-2-oxobutyl)amino]-3,3-dimethylbutan-2-one?
The IUPAC name of 1-[benzyl-(3,3-dimethyl-2-oxobutyl)amino]-3,3-dimethylbutan-2-one (CID 14149398) is 1-[benzyl-(3,3-dimethyl-2-oxobutyl)amino]-3,3-dimethylbutan-2-one.
What is the SMILES notation for 1-[benzyl-(3,3-dimethyl-2-oxobutyl)amino]-3,3-dimethylbutan-2-one?
The canonical SMILES for 1-[benzyl-(3,3-dimethyl-2-oxobutyl)amino]-3,3-dimethylbutan-2-one is CC(C)(C)C(=O)CN(CC(=O)C(C)(C)C)Cc1ccccc1.
What is the InChIKey of 1-[benzyl-(3,3-dimethyl-2-oxobutyl)amino]-3,3-dimethylbutan-2-one?
The InChIKey is UATQWWAGLNQRRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29NO2/c1-18(2,3)16(21)13-20(14-17(22)19(4,5)6)12-15-10-8-7-9-11-15/h7-11H,12-14H2,1-6H3.
What are the key properties of 1-[benzyl-(3,3-dimethyl-2-oxobutyl)amino]-3,3-dimethylbutan-2-one?
1-[benzyl-(3,3-dimethyl-2-oxobutyl)amino]-3,3-dimethylbutan-2-one has a molecular weight of 303.45 g/mol, XLogP of 3.72, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[benzyl-(3,3-dimethyl-2-oxobutyl)amino]-3,3-dimethylbutan-2-one is sourced from PubChem (CID 14149398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).