C26H24FN7O2 — CID 141494039
N-[6-[[2-[(4-fluorophenyl)methoxy]-4-pyrrolidin-1-ylpyrido[3,4-d]pyrimidin-6-yl]amino]-2-pyridinyl]prop-2-enamide (PubChem CID 141494039) has the molecular formula C26H24FN7O2 and a molecular weight of 485.52 g/mol. Its IUPAC name is N-[6-[[2-[(4-fluorophenyl)methoxy]-4-pyrrolidin-1-ylpyrido[3,4-d]pyrimidin-6-yl]amino]-2-pyridinyl]prop-2-enamide.
| Compound Name | N-[6-[[2-[(4-fluorophenyl)methoxy]-4-pyrrolidin-1-ylpyrido[3,4-d]pyrimidin-6-yl]amino]-2-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 141494039 |
| Molecular Formula | C26H24FN7O2 |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | N-[6-[[2-[(4-fluorophenyl)methoxy]-4-pyrrolidin-1-ylpyrido[3,4-d]pyrimidin-6-yl]amino]-2-pyridinyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Nc2cc3c(N4CCCC4)nc(OCc4ccc(F)cc4)nc3cn2)n1 |
| InChI | InChI=1S/C26H24FN7O2/c1-2-24(35)32-22-7-5-6-21(30-22)31-23-14-19-20(15-28-23)29-26(33-25(19)34-12-3-4-13-34)36-16-17-8-10-18(27)11-9-17/h2,5-11,14-15H,1,3-4,12-13,16H2,(H2,28,30,31,32,35) |
| InChIKey | YROPMLCWHUESRV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 105.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|