C11H12FN5OS — CID 141494828
1-(4-fluorophenyl)-3-(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)thiourea (PubChem CID 141494828) has the molecular formula C11H12FN5OS and a molecular weight of 281.32 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)thiourea.
| Compound Name | 1-(4-fluorophenyl)-3-(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)thiourea |
|---|---|
| PubChem CID | 141494828 |
| Molecular Formula | C11H12FN5OS |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 1-(4-fluorophenyl)-3-(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)thiourea |
| SMILES | CC1=NNC(=O)N(NC(=S)Nc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C11H12FN5OS/c1-7-6-17(11(18)15-14-7)16-10(19)13-9-4-2-8(12)3-5-9/h2-5H,6H2,1H3,(H,15,18)(H2,13,16,19) |
| InChIKey | WWKXIZZSFQRFIF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|