C12H12F3N5OS — CID 141494849
1-(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)-3-[4-(trifluoromethyl)phenyl]thiourea (PubChem CID 141494849) has the molecular formula C12H12F3N5OS and a molecular weight of 331.32 g/mol. Its IUPAC name is 1-(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)-3-[4-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)-3-[4-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 141494849 |
| Molecular Formula | C12H12F3N5OS |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 1-(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)-3-[4-(trifluoromethyl)phenyl]thiourea |
| SMILES | CC1=NNC(=O)N(NC(=S)Nc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C12H12F3N5OS/c1-7-6-20(11(21)18-17-7)19-10(22)16-9-4-2-8(3-5-9)12(13,14)15/h2-5H,6H2,1H3,(H,18,21)(H2,16,19,22) |
| InChIKey | ZGAJQSZOKPUKOJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|