C11H10F3N5O2 — CID 141494859
1-(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)-3-(2,4,5-trifluorophenyl)urea (PubChem CID 141494859) has the molecular formula C11H10F3N5O2 and a molecular weight of 301.23 g/mol. Its IUPAC name is 1-(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)-3-(2,4,5-trifluorophenyl)urea.
| Compound Name | 1-(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)-3-(2,4,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 141494859 |
| Molecular Formula | C11H10F3N5O2 |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 1-(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)-3-(2,4,5-trifluorophenyl)urea |
| SMILES | CC1=NNC(=O)N(NC(=O)Nc2cc(F)c(F)cc2F)C1 |
| InChI | InChI=1S/C11H10F3N5O2/c1-5-4-19(11(21)17-16-5)18-10(20)15-9-3-7(13)6(12)2-8(9)14/h2-3H,4H2,1H3,(H,17,21)(H2,15,18,20) |
| InChIKey | SMGRDIBTSOGVSX-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|