C12H14FN7O3S — CID 141494893
S-[2-[(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)carbamoyl]hydrazinyl] N-(4-fluorophenyl)carbamothioate (PubChem CID 141494893) has the molecular formula C12H14FN7O3S and a molecular weight of 355.36 g/mol. Its IUPAC name is S-[2-[(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)carbamoyl]hydrazinyl] N-(4-fluorophenyl)carbamothioate.
| Compound Name | S-[2-[(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)carbamoyl]hydrazinyl] N-(4-fluorophenyl)carbamothioate |
|---|---|
| PubChem CID | 141494893 |
| Molecular Formula | C12H14FN7O3S |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | S-[2-[(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)carbamoyl]hydrazinyl] N-(4-fluorophenyl)carbamothioate |
| SMILES | CC1=NNC(=O)N(NC(=O)NNSC(=O)Nc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C12H14FN7O3S/c1-7-6-20(11(22)17-15-7)18-10(21)16-19-24-12(23)14-9-4-2-8(13)3-5-9/h2-5,19H,6H2,1H3,(H,14,23)(H,17,22)(H2,16,18,21) |
| InChIKey | LRYKTUOHIVOTJX-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 126.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|