C8H15N7O3S — CID 141494899
S-[2-[(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)carbamoyl]hydrazinyl] N-ethylcarbamothioate (PubChem CID 141494899) has the molecular formula C8H15N7O3S and a molecular weight of 289.32 g/mol. Its IUPAC name is S-[2-[(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)carbamoyl]hydrazinyl] N-ethylcarbamothioate.
| Compound Name | S-[2-[(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)carbamoyl]hydrazinyl] N-ethylcarbamothioate |
|---|---|
| PubChem CID | 141494899 |
| Molecular Formula | C8H15N7O3S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | S-[2-[(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)carbamoyl]hydrazinyl] N-ethylcarbamothioate |
| SMILES | CCNC(=O)SNNC(=O)NN1CC(C)=NNC1=O |
| InChI | InChI=1S/C8H15N7O3S/c1-3-9-8(18)19-14-11-6(16)13-15-4-5(2)10-12-7(15)17/h14H,3-4H2,1-2H3,(H,9,18)(H,12,17)(H2,11,13,16) |
| InChIKey | VZGSCYPUQHFYCQ-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 126.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|