C13H16N6O2 — CID 141494944
(3E)-1-[(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)amino]-3-(2-phenylethylidene)urea (PubChem CID 141494944) has the molecular formula C13H16N6O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is (3E)-1-[(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)amino]-3-(2-phenylethylidene)urea.
| Compound Name | (3E)-1-[(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)amino]-3-(2-phenylethylidene)urea |
|---|---|
| PubChem CID | 141494944 |
| Molecular Formula | C13H16N6O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | (3E)-1-[(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)amino]-3-(2-phenylethylidene)urea |
| SMILES | CC1=NNC(=O)N(NNC(=O)/N=C/Cc2ccccc2)C1 |
| InChI | InChI=1S/C13H16N6O2/c1-10-9-19(13(21)17-15-10)18-16-12(20)14-8-7-11-5-3-2-4-6-11/h2-6,8,18H,7,9H2,1H3,(H,16,20)(H,17,21)/b14-8+ |
| InChIKey | SWBJRPLMUWMNLD-RIYZIHGNSA-N |
| XLogP | 0.83 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|