About 6,7-dihydro-5H-pyrrolo[3,2-b]pyridine;hydrochloride
6,7-dihydro-5H-pyrrolo[3,2-b]pyridine;hydrochloride (PubChem CID 141495238) has the molecular formula C7H9ClN2
and a molecular weight of 156.62 g/mol. Its IUPAC name is 6,7-dihydro-5H-pyrrolo[3,2-b]pyridine;hydrochloride.
Molecular Properties
| Compound Name | 6,7-dihydro-5H-pyrrolo[3,2-b]pyridine;hydrochloride |
| PubChem CID | 141495238 |
| Molecular Formula | C7H9ClN2 |
| Molecular Weight | 156.62 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 6,7-dihydro-5H-pyrrolo[3,2-b]pyridine;hydrochloride |
| SMILES | C1=CC2=NCCCC2=N1.Cl |
| InChI | InChI=1S/C7H8N2.ClH/c1-2-6-7(8-4-1)3-5-9-6;/h3,5H,1-2,4H2;1H |
| InChIKey | XUTJRULPMVFDMZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.62 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7-dihydro-5H-pyrrolo[3,2-b]pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydro-5H-pyrrolo[3,2-b]pyridine;hydrochloride?
The IUPAC name of 6,7-dihydro-5H-pyrrolo[3,2-b]pyridine;hydrochloride (CID 141495238) is 6,7-dihydro-5H-pyrrolo[3,2-b]pyridine;hydrochloride.
What is the SMILES notation for 6,7-dihydro-5H-pyrrolo[3,2-b]pyridine;hydrochloride?
The canonical SMILES for 6,7-dihydro-5H-pyrrolo[3,2-b]pyridine;hydrochloride is C1=CC2=NCCCC2=N1.Cl.
What is the InChIKey of 6,7-dihydro-5H-pyrrolo[3,2-b]pyridine;hydrochloride?
The InChIKey is XUTJRULPMVFDMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2.ClH/c1-2-6-7(8-4-1)3-5-9-6;/h3,5H,1-2,4H2;1H.
What are the key properties of 6,7-dihydro-5H-pyrrolo[3,2-b]pyridine;hydrochloride?
6,7-dihydro-5H-pyrrolo[3,2-b]pyridine;hydrochloride has a molecular weight of 156.62 g/mol, XLogP of 1.61, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-5H-pyrrolo[3,2-b]pyridine;hydrochloride is sourced from PubChem (CID 141495238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).