About 4-hydroxy-1-nitrosocyclohexa-2,4-diene-1-carbaldehyde
4-hydroxy-1-nitrosocyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 141495406) has the molecular formula C7H7NO3
and a molecular weight of 153.14 g/mol. Its IUPAC name is 4-hydroxy-1-nitrosocyclohexa-2,4-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 4-hydroxy-1-nitrosocyclohexa-2,4-diene-1-carbaldehyde |
| PubChem CID | 141495406 |
| Molecular Formula | C7H7NO3 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | 4-hydroxy-1-nitrosocyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | O=CC1(N=O)C=CC(O)=CC1 |
| InChI | InChI=1S/C7H7NO3/c9-5-7(8-11)3-1-6(10)2-4-7/h1-3,5,10H,4H2 |
| InChIKey | CFYZESMFVHWPHK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-1-nitrosocyclohexa-2,4-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-1-nitrosocyclohexa-2,4-diene-1-carbaldehyde?
The IUPAC name of 4-hydroxy-1-nitrosocyclohexa-2,4-diene-1-carbaldehyde (CID 141495406) is 4-hydroxy-1-nitrosocyclohexa-2,4-diene-1-carbaldehyde.
What is the SMILES notation for 4-hydroxy-1-nitrosocyclohexa-2,4-diene-1-carbaldehyde?
The canonical SMILES for 4-hydroxy-1-nitrosocyclohexa-2,4-diene-1-carbaldehyde is O=CC1(N=O)C=CC(O)=CC1.
What is the InChIKey of 4-hydroxy-1-nitrosocyclohexa-2,4-diene-1-carbaldehyde?
The InChIKey is CFYZESMFVHWPHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3/c9-5-7(8-11)3-1-6(10)2-4-7/h1-3,5,10H,4H2.
What are the key properties of 4-hydroxy-1-nitrosocyclohexa-2,4-diene-1-carbaldehyde?
4-hydroxy-1-nitrosocyclohexa-2,4-diene-1-carbaldehyde has a molecular weight of 153.14 g/mol, XLogP of 1.09, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-1-nitrosocyclohexa-2,4-diene-1-carbaldehyde is sourced from PubChem (CID 141495406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).