About (Z)-1-ethenoxyethene-1,2-dithiol
(Z)-1-ethenoxyethene-1,2-dithiol (PubChem CID 141496265) has the molecular formula C4H6OS2
and a molecular weight of 134.22 g/mol. Its IUPAC name is (Z)-1-ethenoxyethene-1,2-dithiol.
Molecular Properties
| Compound Name | (Z)-1-ethenoxyethene-1,2-dithiol |
| PubChem CID | 141496265 |
| Molecular Formula | C4H6OS2 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 133.99 |
| IUPAC Name | (Z)-1-ethenoxyethene-1,2-dithiol |
| SMILES | C=CO/C(S)=C/S |
| InChI | InChI=1S/C4H6OS2/c1-2-5-4(7)3-6/h2-3,6-7H,1H2/b4-3- |
| InChIKey | GZVXHRHPSSWOSQ-ARJAWSKDSA-N |
| XLogP | 1.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-ethenoxyethene-1,2-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-ethenoxyethene-1,2-dithiol?
The IUPAC name of (Z)-1-ethenoxyethene-1,2-dithiol (CID 141496265) is (Z)-1-ethenoxyethene-1,2-dithiol.
What is the SMILES notation for (Z)-1-ethenoxyethene-1,2-dithiol?
The canonical SMILES for (Z)-1-ethenoxyethene-1,2-dithiol is C=CO/C(S)=C/S.
What is the InChIKey of (Z)-1-ethenoxyethene-1,2-dithiol?
The InChIKey is GZVXHRHPSSWOSQ-ARJAWSKDSA-N. The full InChI is InChI=1S/C4H6OS2/c1-2-5-4(7)3-6/h2-3,6-7H,1H2/b4-3-.
What are the key properties of (Z)-1-ethenoxyethene-1,2-dithiol?
(Z)-1-ethenoxyethene-1,2-dithiol has a molecular weight of 134.22 g/mol, XLogP of 1.80, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-ethenoxyethene-1,2-dithiol is sourced from PubChem (CID 141496265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).